C9H12N4O6S — CID 61063868
3-(2,4-dinitroanilino)propane-1-sulfonamide (PubChem CID 61063868) has the molecular formula C9H12N4O6S and a molecular weight of 304.28 g/mol. Its IUPAC name is 3-(2,4-dinitroanilino)propane-1-sulfonamide.
| Compound Name | 3-(2,4-dinitroanilino)propane-1-sulfonamide |
|---|---|
| PubChem CID | 61063868 |
| Molecular Formula | C9H12N4O6S |
| Molecular Weight | 304.28 g/mol |
| Exact Mass | 304.05 |
| IUPAC Name | 3-(2,4-dinitroanilino)propane-1-sulfonamide |
| SMILES | NS(=O)(=O)CCCNc1ccc([N+](=O)[O-])cc1[N+](=O)[O-] |
| InChI | InChI=1S/C9H12N4O6S/c10-20(18,19)5-1-4-11-8-3-2-7(12(14)15)6-9(8)13(16)17/h2-3,6,11H,1,4-5H2,(H2,10,18,19) |
| InChIKey | VBXBSQKESIHGTL-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 158.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.28 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|