C8H11N4O4+ — CID 7122512
2-(2,4-dinitroanilino)ethylazanium (PubChem CID 7122512) has the molecular formula C8H11N4O4+ and a molecular weight of 227.20 g/mol. Its IUPAC name is 2-(2,4-dinitroanilino)ethylazanium.
| Compound Name | 2-(2,4-dinitroanilino)ethylazanium |
|---|---|
| PubChem CID | 7122512 |
| Molecular Formula | C8H11N4O4+ |
| Molecular Weight | 227.20 g/mol |
| Exact Mass | 227.08 |
| IUPAC Name | 2-(2,4-dinitroanilino)ethylazanium |
| SMILES | [NH3+]CCNc1ccc([N+](=O)[O-])cc1[N+](=O)[O-] |
| InChI | InChI=1S/C8H10N4O4/c9-3-4-10-7-2-1-6(11(13)14)5-8(7)12(15)16/h1-2,5,10H,3-4,9H2/p+1 |
| InChIKey | AIUKPEQJKQUQKZ-UHFFFAOYSA-O |
| XLogP | 0.16 |
| TPSA | 125.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.20 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|