C10H13N3O5S — CID 115626937
N-(2-ethylsulfinylethyl)-2,4-dinitroaniline (PubChem CID 115626937) has the molecular formula C10H13N3O5S and a molecular weight of 287.30 g/mol. Its IUPAC name is N-(2-ethylsulfinylethyl)-2,4-dinitroaniline.
| Compound Name | N-(2-ethylsulfinylethyl)-2,4-dinitroaniline |
|---|---|
| PubChem CID | 115626937 |
| Molecular Formula | C10H13N3O5S |
| Molecular Weight | 287.30 g/mol |
| Exact Mass | 287.06 |
| IUPAC Name | N-(2-ethylsulfinylethyl)-2,4-dinitroaniline |
| SMILES | CCS(=O)CCNc1ccc([N+](=O)[O-])cc1[N+](=O)[O-] |
| InChI | InChI=1S/C10H13N3O5S/c1-2-19(18)6-5-11-9-4-3-8(12(14)15)7-10(9)13(16)17/h3-4,7,11H,2,5-6H2,1H3 |
| InChIKey | WBOZBLPHNVPKKN-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 115.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.30 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|