C20H33N3O10 — CID 162495808
N-[2-[2-[2-[2-[2-(2-ethoxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethyl]-2,4-dinitroaniline (PubChem CID 162495808) has the molecular formula C20H33N3O10 and a molecular weight of 475.50 g/mol. Its IUPAC name is N-[2-[2-[2-[2-[2-(2-ethoxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethyl]-2,4-dinitroaniline.
| Compound Name | N-[2-[2-[2-[2-[2-(2-ethoxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethyl]-2,4-dinitroaniline |
|---|---|
| PubChem CID | 162495808 |
| Molecular Formula | C20H33N3O10 |
| Molecular Weight | 475.50 g/mol |
| Exact Mass | 475.22 |
| IUPAC Name | N-[2-[2-[2-[2-[2-(2-ethoxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethyl]-2,4-dinitroaniline |
| SMILES | CCOCCOCCOCCOCCOCCOCCNc1ccc([N+](=O)[O-])cc1[N+](=O)[O-] |
| InChI | InChI=1S/C20H33N3O10/c1-2-28-7-8-30-11-12-32-15-16-33-14-13-31-10-9-29-6-5-21-19-4-3-18(22(24)25)17-20(19)23(26)27/h3-4,17,21H,2,5-16H2,1H3 |
| InChIKey | VPEILLHEEHHMES-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 153.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.50 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|