C11H12BrN3O6 — CID 71406807
2-(2,4-dinitroanilino)ethyl 2-bromopropanoate (PubChem CID 71406807) has the molecular formula C11H12BrN3O6 and a molecular weight of 362.14 g/mol. Its IUPAC name is 2-(2,4-dinitroanilino)ethyl 2-bromopropanoate.
| Compound Name | 2-(2,4-dinitroanilino)ethyl 2-bromopropanoate |
|---|---|
| PubChem CID | 71406807 |
| Molecular Formula | C11H12BrN3O6 |
| Molecular Weight | 362.14 g/mol |
| Exact Mass | 360.99 |
| IUPAC Name | 2-(2,4-dinitroanilino)ethyl 2-bromopropanoate |
| SMILES | CC(Br)C(=O)OCCNc1ccc([N+](=O)[O-])cc1[N+](=O)[O-] |
| InChI | InChI=1S/C11H12BrN3O6/c1-7(12)11(16)21-5-4-13-9-3-2-8(14(17)18)6-10(9)15(19)20/h2-3,6-7,13H,4-5H2,1H3 |
| InChIKey | XZCKIMWIFWHGPJ-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 124.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.14 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|