C14H19N5O6 — CID 10428137
(2S)-2-[3-(2,4-dinitroanilino)propanoylamino]-3-methylbutanamide (PubChem CID 10428137) has the molecular formula C14H19N5O6 and a molecular weight of 353.34 g/mol. Its IUPAC name is (2S)-2-[3-(2,4-dinitroanilino)propanoylamino]-3-methylbutanamide.
| Compound Name | (2S)-2-[3-(2,4-dinitroanilino)propanoylamino]-3-methylbutanamide |
|---|---|
| PubChem CID | 10428137 |
| Molecular Formula | C14H19N5O6 |
| Molecular Weight | 353.34 g/mol |
| Exact Mass | 353.13 |
| IUPAC Name | (2S)-2-[3-(2,4-dinitroanilino)propanoylamino]-3-methylbutanamide |
| SMILES | CC(C)[C@H](NC(=O)CCNc1ccc([N+](=O)[O-])cc1[N+](=O)[O-])C(N)=O |
| InChI | InChI=1S/C14H19N5O6/c1-8(2)13(14(15)21)17-12(20)5-6-16-10-4-3-9(18(22)23)7-11(10)19(24)25/h3-4,7-8,13,16H,5-6H2,1-2H3,(H2,15,21)(H,17,20)/t13-/m0/s1 |
| InChIKey | CWCYXCCRABIXSM-ZDUSSCGKSA-N |
| XLogP | 0.93 |
| TPSA | 170.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.34 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|