C18H24N4O8 — CID 88884668
prop-2-enyl (2S)-2-[6-(2,4-dinitroanilino)hexanoylamino]-3-hydroxypropanoate (PubChem CID 88884668) has the molecular formula C18H24N4O8 and a molecular weight of 424.41 g/mol. Its IUPAC name is prop-2-enyl (2S)-2-[6-(2,4-dinitroanilino)hexanoylamino]-3-hydroxypropanoate.
| Compound Name | prop-2-enyl (2S)-2-[6-(2,4-dinitroanilino)hexanoylamino]-3-hydroxypropanoate |
|---|---|
| PubChem CID | 88884668 |
| Molecular Formula | C18H24N4O8 |
| Molecular Weight | 424.41 g/mol |
| Exact Mass | 424.16 |
| IUPAC Name | prop-2-enyl (2S)-2-[6-(2,4-dinitroanilino)hexanoylamino]-3-hydroxypropanoate |
| SMILES | C=CCOC(=O)[C@H](CO)NC(=O)CCCCCNc1ccc([N+](=O)[O-])cc1[N+](=O)[O-] |
| InChI | InChI=1S/C18H24N4O8/c1-2-10-30-18(25)15(12-23)20-17(24)6-4-3-5-9-19-14-8-7-13(21(26)27)11-16(14)22(28)29/h2,7-8,11,15,19,23H,1,3-6,9-10,12H2,(H,20,24)/t15-/m0/s1 |
| InChIKey | MAUKFNVSCWFWCO-HNNXBMFYSA-N |
| XLogP | 1.68 |
| TPSA | 173.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.41 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|