C16H19N5O8 — CID 101223317
(2,5-dioxopyrrolidin-1-yl) 2-amino-6-(2,4-dinitroanilino)hexanoate (PubChem CID 101223317) has the molecular formula C16H19N5O8 and a molecular weight of 409.36 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) 2-amino-6-(2,4-dinitroanilino)hexanoate.
| Compound Name | (2,5-dioxopyrrolidin-1-yl) 2-amino-6-(2,4-dinitroanilino)hexanoate |
|---|---|
| PubChem CID | 101223317 |
| Molecular Formula | C16H19N5O8 |
| Molecular Weight | 409.36 g/mol |
| Exact Mass | 409.12 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) 2-amino-6-(2,4-dinitroanilino)hexanoate |
| SMILES | NC(CCCCNc1ccc([N+](=O)[O-])cc1[N+](=O)[O-])C(=O)ON1C(=O)CCC1=O |
| InChI | InChI=1S/C16H19N5O8/c17-11(16(24)29-19-14(22)6-7-15(19)23)3-1-2-8-18-12-5-4-10(20(25)26)9-13(12)21(27)28/h4-5,9,11,18H,1-3,6-8,17H2 |
| InChIKey | JZHVCYBYNQTHJM-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 188.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.36 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|