C16H18N4O8 — CID 87531206
(2,5-dioxopyrrolidin-1-yl) 6-amino-6-(2,4-dinitrophenyl)hexanoate (PubChem CID 87531206) has the molecular formula C16H18N4O8 and a molecular weight of 394.34 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) 6-amino-6-(2,4-dinitrophenyl)hexanoate.
| Compound Name | (2,5-dioxopyrrolidin-1-yl) 6-amino-6-(2,4-dinitrophenyl)hexanoate |
|---|---|
| PubChem CID | 87531206 |
| Molecular Formula | C16H18N4O8 |
| Molecular Weight | 394.34 g/mol |
| Exact Mass | 394.11 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) 6-amino-6-(2,4-dinitrophenyl)hexanoate |
| SMILES | NC(CCCCC(=O)ON1C(=O)CCC1=O)c1ccc([N+](=O)[O-])cc1[N+](=O)[O-] |
| InChI | InChI=1S/C16H18N4O8/c17-12(11-6-5-10(19(24)25)9-13(11)20(26)27)3-1-2-4-16(23)28-18-14(21)7-8-15(18)22/h5-6,9,12H,1-4,7-8,17H2 |
| InChIKey | DGFZCVHLKBGWSU-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 175.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.34 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|