C23H26N2O11 — CID 170751512
7-O-(2,5-dioxopyrrolidin-1-yl) 1-O-[1-(5-methoxy-2-nitro-4-prop-2-enoyloxyphenyl)ethyl] heptanedioate (PubChem CID 170751512) has the molecular formula C23H26N2O11 and a molecular weight of 506.46 g/mol. Its IUPAC name is 7-O-(2,5-dioxopyrrolidin-1-yl) 1-O-[1-(5-methoxy-2-nitro-4-prop-2-enoyloxyphenyl)ethyl] heptanedioate.
| Compound Name | 7-O-(2,5-dioxopyrrolidin-1-yl) 1-O-[1-(5-methoxy-2-nitro-4-prop-2-enoyloxyphenyl)ethyl] heptanedioate |
|---|---|
| PubChem CID | 170751512 |
| Molecular Formula | C23H26N2O11 |
| Molecular Weight | 506.46 g/mol |
| Exact Mass | 506.15 |
| IUPAC Name | 7-O-(2,5-dioxopyrrolidin-1-yl) 1-O-[1-(5-methoxy-2-nitro-4-prop-2-enoyloxyphenyl)ethyl] heptanedioate |
| SMILES | C=CC(=O)Oc1cc([N+](=O)[O-])c(C(C)OC(=O)CCCCCC(=O)ON2C(=O)CCC2=O)cc1OC |
| InChI | InChI=1S/C23H26N2O11/c1-4-21(28)35-18-13-16(25(31)32)15(12-17(18)33-3)14(2)34-22(29)8-6-5-7-9-23(30)36-24-19(26)10-11-20(24)27/h4,12-14H,1,5-11H2,2-3H3 |
| InChIKey | NKZONGZMTHEIHO-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 168.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.46 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|