C23H30N2O10 — CID 163215079
2-[2-[4-[2-methoxy-5-nitro-4-(1-prop-2-enoyloxyethyl)phenoxy]butanoylamino]ethoxy]ethyl prop-2-enoate (PubChem CID 163215079) has the molecular formula C23H30N2O10 and a molecular weight of 494.50 g/mol. Its IUPAC name is 2-[2-[4-[2-methoxy-5-nitro-4-(1-prop-2-enoyloxyethyl)phenoxy]butanoylamino]ethoxy]ethyl prop-2-enoate.
| Compound Name | 2-[2-[4-[2-methoxy-5-nitro-4-(1-prop-2-enoyloxyethyl)phenoxy]butanoylamino]ethoxy]ethyl prop-2-enoate |
|---|---|
| PubChem CID | 163215079 |
| Molecular Formula | C23H30N2O10 |
| Molecular Weight | 494.50 g/mol |
| Exact Mass | 494.19 |
| IUPAC Name | 2-[2-[4-[2-methoxy-5-nitro-4-(1-prop-2-enoyloxyethyl)phenoxy]butanoylamino]ethoxy]ethyl prop-2-enoate |
| SMILES | C=CC(=O)OCCOCCNC(=O)CCCOc1cc([N+](=O)[O-])c(C(C)OC(=O)C=C)cc1OC |
| InChI | InChI=1S/C23H30N2O10/c1-5-22(27)34-13-12-32-11-9-24-21(26)8-7-10-33-20-15-18(25(29)30)17(14-19(20)31-4)16(3)35-23(28)6-2/h5-6,14-16H,1-2,7-13H2,3-4H3,(H,24,26) |
| InChIKey | BLUZRFHQNQMJJG-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 152.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.50 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|