C14H20N2O7 — CID 168725746
1-[5-methoxy-4-(2-methoxyethoxy)-2-nitrophenyl]ethyl N-methylcarbamate (PubChem CID 168725746) has the molecular formula C14H20N2O7 and a molecular weight of 328.32 g/mol. Its IUPAC name is 1-[5-methoxy-4-(2-methoxyethoxy)-2-nitrophenyl]ethyl N-methylcarbamate.
| Compound Name | 1-[5-methoxy-4-(2-methoxyethoxy)-2-nitrophenyl]ethyl N-methylcarbamate |
|---|---|
| PubChem CID | 168725746 |
| Molecular Formula | C14H20N2O7 |
| Molecular Weight | 328.32 g/mol |
| Exact Mass | 328.13 |
| IUPAC Name | 1-[5-methoxy-4-(2-methoxyethoxy)-2-nitrophenyl]ethyl N-methylcarbamate |
| SMILES | CNC(=O)OC(C)c1cc(OC)c(OCCOC)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C14H20N2O7/c1-9(23-14(17)15-2)10-7-12(21-4)13(22-6-5-20-3)8-11(10)16(18)19/h7-9H,5-6H2,1-4H3,(H,15,17) |
| InChIKey | UZZGRQZOGCCOKT-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 109.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.32 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|