C19H30N2O6 — CID 167353357
1-[4-(2,2-dimethylpropoxy)-5-methoxy-2-nitrophenyl]ethyl N-tert-butylcarbamate (PubChem CID 167353357) has the molecular formula C19H30N2O6 and a molecular weight of 382.46 g/mol. Its IUPAC name is 1-[4-(2,2-dimethylpropoxy)-5-methoxy-2-nitrophenyl]ethyl N-tert-butylcarbamate.
| Compound Name | 1-[4-(2,2-dimethylpropoxy)-5-methoxy-2-nitrophenyl]ethyl N-tert-butylcarbamate |
|---|---|
| PubChem CID | 167353357 |
| Molecular Formula | C19H30N2O6 |
| Molecular Weight | 382.46 g/mol |
| Exact Mass | 382.21 |
| IUPAC Name | 1-[4-(2,2-dimethylpropoxy)-5-methoxy-2-nitrophenyl]ethyl N-tert-butylcarbamate |
| SMILES | COc1cc(C(C)OC(=O)NC(C)(C)C)c([N+](=O)[O-])cc1OCC(C)(C)C |
| InChI | InChI=1S/C19H30N2O6/c1-12(27-17(22)20-19(5,6)7)13-9-15(25-8)16(10-14(13)21(23)24)26-11-18(2,3)4/h9-10,12H,11H2,1-8H3,(H,20,22) |
| InChIKey | WTIHFGKOPDVTCS-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 99.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.46 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|