C26H42N2O7 — CID 166734457
1-[5-methoxy-2-nitro-4-[(E)-2-nonan-5-yloxybut-1-enoxy]phenyl]ethyl N-propan-2-ylcarbamate (PubChem CID 166734457) has the molecular formula C26H42N2O7 and a molecular weight of 494.63 g/mol. Its IUPAC name is 1-[5-methoxy-2-nitro-4-[(E)-2-nonan-5-yloxybut-1-enoxy]phenyl]ethyl N-propan-2-ylcarbamate.
| Compound Name | 1-[5-methoxy-2-nitro-4-[(E)-2-nonan-5-yloxybut-1-enoxy]phenyl]ethyl N-propan-2-ylcarbamate |
|---|---|
| PubChem CID | 166734457 |
| Molecular Formula | C26H42N2O7 |
| Molecular Weight | 494.63 g/mol |
| Exact Mass | 494.30 |
| IUPAC Name | 1-[5-methoxy-2-nitro-4-[(E)-2-nonan-5-yloxybut-1-enoxy]phenyl]ethyl N-propan-2-ylcarbamate |
| SMILES | CCCCC(CCCC)O/C(=C/Oc1cc([N+](=O)[O-])c(C(C)OC(=O)NC(C)C)cc1OC)CC |
| InChI | InChI=1S/C26H42N2O7/c1-8-11-13-21(14-12-9-2)35-20(10-3)17-33-25-16-23(28(30)31)22(15-24(25)32-7)19(6)34-26(29)27-18(4)5/h15-19,21H,8-14H2,1-7H3,(H,27,29)/b20-17+ |
| InChIKey | IBKHIXGUVLNORH-LVZFUZTISA-N |
| XLogP | 7.19 |
| TPSA | 109.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.63 |
| LogP ≤ 5 | 7.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|