C19H28N2O8 — CID 14523309
1-(4,5-dimethoxy-2-nitrophenyl)ethyl 4-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate (PubChem CID 14523309) has the molecular formula C19H28N2O8 and a molecular weight of 412.44 g/mol. Its IUPAC name is 1-(4,5-dimethoxy-2-nitrophenyl)ethyl 4-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate.
| Compound Name | 1-(4,5-dimethoxy-2-nitrophenyl)ethyl 4-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate |
|---|---|
| PubChem CID | 14523309 |
| Molecular Formula | C19H28N2O8 |
| Molecular Weight | 412.44 g/mol |
| Exact Mass | 412.18 |
| IUPAC Name | 1-(4,5-dimethoxy-2-nitrophenyl)ethyl 4-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate |
| SMILES | COc1cc(C(C)OC(=O)CCCNC(=O)OC(C)(C)C)c([N+](=O)[O-])cc1OC |
| InChI | InChI=1S/C19H28N2O8/c1-12(13-10-15(26-5)16(27-6)11-14(13)21(24)25)28-17(22)8-7-9-20-18(23)29-19(2,3)4/h10-12H,7-9H2,1-6H3,(H,20,23) |
| InChIKey | LUJDJTBNBAPMQP-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 126.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.44 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|