C20H33NO9Si — CID 102049360
1-(4,5-dimethoxy-2-nitrophenyl)butyl 5-trimethoxysilylpentanoate (PubChem CID 102049360) has the molecular formula C20H33NO9Si and a molecular weight of 459.57 g/mol. Its IUPAC name is 1-(4,5-dimethoxy-2-nitrophenyl)butyl 5-trimethoxysilylpentanoate.
| Compound Name | 1-(4,5-dimethoxy-2-nitrophenyl)butyl 5-trimethoxysilylpentanoate |
|---|---|
| PubChem CID | 102049360 |
| Molecular Formula | C20H33NO9Si |
| Molecular Weight | 459.57 g/mol |
| Exact Mass | 459.19 |
| IUPAC Name | 1-(4,5-dimethoxy-2-nitrophenyl)butyl 5-trimethoxysilylpentanoate |
| SMILES | CCCC(OC(=O)CCCC[Si](OC)(OC)OC)c1cc(OC)c(OC)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C20H33NO9Si/c1-7-10-17(15-13-18(25-2)19(26-3)14-16(15)21(23)24)30-20(22)11-8-9-12-31(27-4,28-5)29-6/h13-14,17H,7-12H2,1-6H3 |
| InChIKey | DZDLVDOWXKQLDU-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 115.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.57 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|