C13H14N2O6 — CID 26435273
methyl (3S)-3-cyano-3-(4,5-dimethoxy-2-nitrophenyl)propanoate (PubChem CID 26435273) has the molecular formula C13H14N2O6 and a molecular weight of 294.26 g/mol. Its IUPAC name is methyl (3S)-3-cyano-3-(4,5-dimethoxy-2-nitrophenyl)propanoate.
| Compound Name | methyl (3S)-3-cyano-3-(4,5-dimethoxy-2-nitrophenyl)propanoate |
|---|---|
| PubChem CID | 26435273 |
| Molecular Formula | C13H14N2O6 |
| Molecular Weight | 294.26 g/mol |
| Exact Mass | 294.09 |
| IUPAC Name | methyl (3S)-3-cyano-3-(4,5-dimethoxy-2-nitrophenyl)propanoate |
| SMILES | COC(=O)C[C@H](C#N)c1cc(OC)c(OC)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C13H14N2O6/c1-19-11-5-9(8(7-14)4-13(16)21-3)10(15(17)18)6-12(11)20-2/h5-6,8H,4H2,1-3H3/t8-/m1/s1 |
| InChIKey | HRWRBHWBIXXULQ-MRVPVSSYSA-N |
| XLogP | 1.78 |
| TPSA | 111.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.26 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|