C26H32F5NO10Si — CID 122392210
1-[5-methoxy-2-nitro-4-[3-(2,3,4,5,6-pentafluorophenoxy)propoxy]phenyl]ethyl 5-trimethoxysilylpentanoate (PubChem CID 122392210) has the molecular formula C26H32F5NO10Si and a molecular weight of 641.62 g/mol. Its IUPAC name is 1-[5-methoxy-2-nitro-4-[3-(2,3,4,5,6-pentafluorophenoxy)propoxy]phenyl]ethyl 5-trimethoxysilylpentanoate.
| Compound Name | 1-[5-methoxy-2-nitro-4-[3-(2,3,4,5,6-pentafluorophenoxy)propoxy]phenyl]ethyl 5-trimethoxysilylpentanoate |
|---|---|
| PubChem CID | 122392210 |
| Molecular Formula | C26H32F5NO10Si |
| Molecular Weight | 641.62 g/mol |
| Exact Mass | 641.17 |
| IUPAC Name | 1-[5-methoxy-2-nitro-4-[3-(2,3,4,5,6-pentafluorophenoxy)propoxy]phenyl]ethyl 5-trimethoxysilylpentanoate |
| SMILES | COc1cc(C(C)OC(=O)CCCC[Si](OC)(OC)OC)c([N+](=O)[O-])cc1OCCCOc1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C26H32F5NO10Si/c1-15(42-20(33)9-6-7-12-43(37-3,38-4)39-5)16-13-18(36-2)19(14-17(16)32(34)35)40-10-8-11-41-26-24(30)22(28)21(27)23(29)25(26)31/h13-15H,6-12H2,1-5H3 |
| InChIKey | OPWZZBPYKHSEKQ-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 124.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 641.62 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'} |
|---|