C22H32N4O9S2 — CID 134380420
[4-[1-[4-[4-[(4-amino-4-oxobutyl)sulfanylamino]-4-oxobutoxy]-5-methoxy-2-nitrophenyl]ethoxy]-4-oxobutyl]carbamothioic S-acid (PubChem CID 134380420) has the molecular formula C22H32N4O9S2 and a molecular weight of 560.65 g/mol. Its IUPAC name is [4-[1-[4-[4-[(4-amino-4-oxobutyl)sulfanylamino]-4-oxobutoxy]-5-methoxy-2-nitrophenyl]ethoxy]-4-oxobutyl]carbamothioic S-acid.
| Compound Name | [4-[1-[4-[4-[(4-amino-4-oxobutyl)sulfanylamino]-4-oxobutoxy]-5-methoxy-2-nitrophenyl]ethoxy]-4-oxobutyl]carbamothioic S-acid |
|---|---|
| PubChem CID | 134380420 |
| Molecular Formula | C22H32N4O9S2 |
| Molecular Weight | 560.65 g/mol |
| Exact Mass | 560.16 |
| IUPAC Name | [4-[1-[4-[4-[(4-amino-4-oxobutyl)sulfanylamino]-4-oxobutoxy]-5-methoxy-2-nitrophenyl]ethoxy]-4-oxobutyl]carbamothioic S-acid |
| SMILES | COc1cc(C(C)OC(=O)CCCNC(=O)S)c([N+](=O)[O-])cc1OCCCC(=O)NSCCCC(N)=O |
| InChI | InChI=1S/C22H32N4O9S2/c1-14(35-21(29)8-3-9-24-22(30)36)15-12-17(33-2)18(13-16(15)26(31)32)34-10-4-7-20(28)25-37-11-5-6-19(23)27/h12-14H,3-11H2,1-2H3,(H2,23,27)(H,25,28)(H2,24,30,36) |
| InChIKey | ADPHZDGOKYXFDJ-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 189.19 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.65 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|