C28H44N6O11 — CID 176552008
4-[[1-amino-6-[4-[4-[1-(4-aminobutanoyloxy)ethyl]-2-methoxy-5-nitrophenoxy]butanoylamino]-1-oxohexan-2-yl]amino]-3-(methylamino)-4-oxobutanoic acid (PubChem CID 176552008) has the molecular formula C28H44N6O11 and a molecular weight of 640.69 g/mol. Its IUPAC name is 4-[[1-amino-6-[4-[4-[1-(4-aminobutanoyloxy)ethyl]-2-methoxy-5-nitrophenoxy]butanoylamino]-1-oxohexan-2-yl]amino]-3-(methylamino)-4-oxobutanoic acid.
| Compound Name | 4-[[1-amino-6-[4-[4-[1-(4-aminobutanoyloxy)ethyl]-2-methoxy-5-nitrophenoxy]butanoylamino]-1-oxohexan-2-yl]amino]-3-(methylamino)-4-oxobutanoic acid |
|---|---|
| PubChem CID | 176552008 |
| Molecular Formula | C28H44N6O11 |
| Molecular Weight | 640.69 g/mol |
| Exact Mass | 640.31 |
| IUPAC Name | 4-[[1-amino-6-[4-[4-[1-(4-aminobutanoyloxy)ethyl]-2-methoxy-5-nitrophenoxy]butanoylamino]-1-oxohexan-2-yl]amino]-3-(methylamino)-4-oxobutanoic acid |
| SMILES | CNC(CC(=O)O)C(=O)NC(CCCCNC(=O)CCCOc1cc([N+](=O)[O-])c(C(C)OC(=O)CCCN)cc1OC)C(N)=O |
| InChI | InChI=1S/C28H44N6O11/c1-17(45-26(38)10-6-11-29)18-14-22(43-3)23(16-21(18)34(41)42)44-13-7-9-24(35)32-12-5-4-8-19(27(30)39)33-28(40)20(31-2)15-25(36)37/h14,16-17,19-20,31H,4-13,15,29H2,1-3H3,(H2,30,39)(H,32,35)(H,33,40)(H,36,37) |
| InChIKey | VKQPXXWFIVXWMC-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 264.54 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 45 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.69 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|