C29H43N5O9S — CID 11157976
4-[4-[1-[6-[5-[(3aR,4R,6aS)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]pentanoylamino]hexanoylamino]ethyl]-2-methoxy-5-nitrophenoxy]butanoic acid (PubChem CID 11157976) has the molecular formula C29H43N5O9S and a molecular weight of 637.76 g/mol. Its IUPAC name is 4-[4-[1-[6-[5-[(3aR,4R,6aS)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]pentanoylamino]hexanoylamino]ethyl]-2-methoxy-5-nitrophenoxy]butanoic acid.
| Compound Name | 4-[4-[1-[6-[5-[(3aR,4R,6aS)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]pentanoylamino]hexanoylamino]ethyl]-2-methoxy-5-nitrophenoxy]butanoic acid |
|---|---|
| PubChem CID | 11157976 |
| Molecular Formula | C29H43N5O9S |
| Molecular Weight | 637.76 g/mol |
| Exact Mass | 637.28 |
| IUPAC Name | 4-[4-[1-[6-[5-[(3aR,4R,6aS)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]pentanoylamino]hexanoylamino]ethyl]-2-methoxy-5-nitrophenoxy]butanoic acid |
| SMILES | COc1cc(C(C)NC(=O)CCCCCNC(=O)CCCC[C@H]2SC[C@H]3NC(=O)N[C@H]32)c([N+](=O)[O-])cc1OCCCC(=O)O |
| InChI | InChI=1S/C29H43N5O9S/c1-18(19-15-22(42-2)23(16-21(19)34(40)41)43-14-8-12-27(37)38)31-26(36)11-4-3-7-13-30-25(35)10-6-5-9-24-28-20(17-44-24)32-29(39)33-28/h15-16,18,20,24,28H,3-14,17H2,1-2H3,(H,30,35)(H,31,36)(H,37,38)(H2,32,33,39)/t18?,20-,24-,28-/m1/s1 |
| InChIKey | YDQNAJZQSDUCIN-GGBPTAKJSA-N |
| XLogP | 3.43 |
| TPSA | 198.23 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 637.76 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'biotin_analogue', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|