C32H40N6O12S — CID 102108512
1-[5-methoxy-2-nitro-4-[4-oxo-4-[2-[5-(2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl)pentanoylamino]ethylamino]butoxy]phenyl]ethyl (4-nitrophenyl) carbonate (PubChem CID 102108512) has the molecular formula C32H40N6O12S and a molecular weight of 732.77 g/mol. Its IUPAC name is 1-[5-methoxy-2-nitro-4-[4-oxo-4-[2-[5-(2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl)pentanoylamino]ethylamino]butoxy]phenyl]ethyl (4-nitrophenyl) carbonate.
| Compound Name | 1-[5-methoxy-2-nitro-4-[4-oxo-4-[2-[5-(2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl)pentanoylamino]ethylamino]butoxy]phenyl]ethyl (4-nitrophenyl) carbonate |
|---|---|
| PubChem CID | 102108512 |
| Molecular Formula | C32H40N6O12S |
| Molecular Weight | 732.77 g/mol |
| Exact Mass | 732.24 |
| IUPAC Name | 1-[5-methoxy-2-nitro-4-[4-oxo-4-[2-[5-(2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl)pentanoylamino]ethylamino]butoxy]phenyl]ethyl (4-nitrophenyl) carbonate |
| SMILES | COc1cc(C(C)OC(=O)Oc2ccc([N+](=O)[O-])cc2)c([N+](=O)[O-])cc1OCCCC(=O)NCCNC(=O)CCCCC1SCC2NC(=O)NC21 |
| InChI | InChI=1S/C32H40N6O12S/c1-19(49-32(42)50-21-11-9-20(10-12-21)37(43)44)22-16-25(47-2)26(17-24(22)38(45)46)48-15-5-8-29(40)34-14-13-33-28(39)7-4-3-6-27-30-23(18-51-27)35-31(41)36-30/h9-12,16-17,19,23,27,30H,3-8,13-15,18H2,1-2H3,(H,33,39)(H,34,40)(H2,35,36,41) |
| InChIKey | VHQPJYXQAIWDGG-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 239.60 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 732.77 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'biotin_analogue', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|