C24H29N4O7PS — CID 101099607
N-[4-[[methoxy-(4-nitrophenoxy)phosphoryl]methyl]phenyl]-5-(2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl)pentanamide (PubChem CID 101099607) has the molecular formula C24H29N4O7PS and a molecular weight of 548.56 g/mol. Its IUPAC name is N-[4-[[methoxy-(4-nitrophenoxy)phosphoryl]methyl]phenyl]-5-(2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl)pentanamide.
| Compound Name | N-[4-[[methoxy-(4-nitrophenoxy)phosphoryl]methyl]phenyl]-5-(2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl)pentanamide |
|---|---|
| PubChem CID | 101099607 |
| Molecular Formula | C24H29N4O7PS |
| Molecular Weight | 548.56 g/mol |
| Exact Mass | 548.15 |
| IUPAC Name | N-[4-[[methoxy-(4-nitrophenoxy)phosphoryl]methyl]phenyl]-5-(2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl)pentanamide |
| SMILES | COP(=O)(Cc1ccc(NC(=O)CCCCC2SCC3NC(=O)NC32)cc1)Oc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C24H29N4O7PS/c1-34-36(33,35-19-12-10-18(11-13-19)28(31)32)14-16-6-8-17(9-7-16)25-22(29)5-3-2-4-21-23-20(15-37-21)26-24(30)27-23/h6-13,20-21,23H,2-5,14-15H2,1H3,(H,25,29)(H2,26,27,30) |
| InChIKey | HHUIPFFDTLXXAG-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 148.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.56 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'biotin_analogue', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|