C24H33N3O5S — CID 143732889
ethyl (E)-2-[2-[4-[5-[(3aS,4S,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]pentanoylamino]phenyl]ethyl]-4-hydroxybut-2-enoate (PubChem CID 143732889) has the molecular formula C24H33N3O5S and a molecular weight of 475.61 g/mol. Its IUPAC name is ethyl (E)-2-[2-[4-[5-[(3aS,4S,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]pentanoylamino]phenyl]ethyl]-4-hydroxybut-2-enoate.
| Compound Name | ethyl (E)-2-[2-[4-[5-[(3aS,4S,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]pentanoylamino]phenyl]ethyl]-4-hydroxybut-2-enoate |
|---|---|
| PubChem CID | 143732889 |
| Molecular Formula | C24H33N3O5S |
| Molecular Weight | 475.61 g/mol |
| Exact Mass | 475.21 |
| IUPAC Name | ethyl (E)-2-[2-[4-[5-[(3aS,4S,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]pentanoylamino]phenyl]ethyl]-4-hydroxybut-2-enoate |
| SMILES | CCOC(=O)/C(=C/CO)CCc1ccc(NC(=O)CCCC[C@@H]2SC[C@@H]3NC(=O)N[C@@H]32)cc1 |
| InChI | InChI=1S/C24H33N3O5S/c1-2-32-23(30)17(13-14-28)10-7-16-8-11-18(12-9-16)25-21(29)6-4-3-5-20-22-19(15-33-20)26-24(31)27-22/h8-9,11-13,19-20,22,28H,2-7,10,14-15H2,1H3,(H,25,29)(H2,26,27,31)/b17-13+/t19-,20-,22-/m0/s1 |
| InChIKey | SSZKTCMBEVDLLU-GKIQGVISSA-N |
| XLogP | 2.77 |
| TPSA | 116.76 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.61 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'biotin_analogue', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|