C16H22AsN3O4S — CID 139025555
[4-[5-[(4S)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]pentanoylamino]phenyl]arsonous acid (PubChem CID 139025555) has the molecular formula C16H22AsN3O4S and a molecular weight of 427.36 g/mol. Its IUPAC name is [4-[5-[(4S)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]pentanoylamino]phenyl]arsonous acid.
| Compound Name | [4-[5-[(4S)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]pentanoylamino]phenyl]arsonous acid |
|---|---|
| PubChem CID | 139025555 |
| Molecular Formula | C16H22AsN3O4S |
| Molecular Weight | 427.36 g/mol |
| Exact Mass | 427.05 |
| IUPAC Name | [4-[5-[(4S)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]pentanoylamino]phenyl]arsonous acid |
| SMILES | O=C(CCCC[C@@H]1SCC2NC(=O)NC21)Nc1ccc([As](O)O)cc1 |
| InChI | InChI=1S/C16H22AsN3O4S/c21-14(18-11-7-5-10(6-8-11)17(23)24)4-2-1-3-13-15-12(9-25-13)19-16(22)20-15/h5-8,12-13,15,23-24H,1-4,9H2,(H,18,21)(H2,19,20,22)/t12?,13-,15?/m0/s1 |
| InChIKey | KIGNHFTUMFFUSZ-OWYJLGKBSA-N |
| XLogP | 0.03 |
| TPSA | 110.69 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.36 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'biotin_analogue', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|