C18H25IrN5O4S2-2 — CID 86223065
[4-[5-[(3aS,4S,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]pentanoylamino]phenyl]sulfonyl-(2-azanidylethyl)azanide;iridium (PubChem CID 86223065) has the molecular formula C18H25IrN5O4S2-2 and a molecular weight of 631.78 g/mol. Its IUPAC name is [4-[5-[(3aS,4S,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]pentanoylamino]phenyl]sulfonyl-(2-azanidylethyl)azanide;iridium.
| Compound Name | [4-[5-[(3aS,4S,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]pentanoylamino]phenyl]sulfonyl-(2-azanidylethyl)azanide;iridium |
|---|---|
| PubChem CID | 86223065 |
| Molecular Formula | C18H25IrN5O4S2-2 |
| Molecular Weight | 631.78 g/mol |
| Exact Mass | 632.10 |
| IUPAC Name | [4-[5-[(3aS,4S,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]pentanoylamino]phenyl]sulfonyl-(2-azanidylethyl)azanide;iridium |
| SMILES | [Ir].[NH-]CC[N-]S(=O)(=O)c1ccc(NC(=O)CCCC[C@@H]2SC[C@@H]3NC(=O)N[C@@H]32)cc1 |
| InChI | InChI=1S/C18H25N5O4S2.Ir/c19-9-10-20-29(26,27)13-7-5-12(6-8-13)21-16(24)4-2-1-3-15-17-14(11-28-15)22-18(25)23-17;/h5-8,14-15,17,19H,1-4,9-11H2,(H,21,24)(H2,22,23,25);/q-2;/t14-,15-,17-;/m0./s1 |
| InChIKey | YQWTYBORIKHRGA-HAGMFFOZSA-N |
| XLogP | 2.46 |
| TPSA | 142.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 631.78 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'biotin_analogue', 'substructure': 'N/A'} |
|---|