C23H32N7O7PS — CID 24806145
5-[(3aS,4S,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]-N-[[1-[2-[ethoxy-(4-nitrophenoxy)phosphoryl]ethyl]triazol-4-yl]methyl]pentanamide (PubChem CID 24806145) has the molecular formula C23H32N7O7PS and a molecular weight of 581.59 g/mol. Its IUPAC name is 5-[(3aS,4S,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]-N-[[1-[2-[ethoxy-(4-nitrophenoxy)phosphoryl]ethyl]triazol-4-yl]methyl]pentanamide.
| Compound Name | 5-[(3aS,4S,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]-N-[[1-[2-[ethoxy-(4-nitrophenoxy)phosphoryl]ethyl]triazol-4-yl]methyl]pentanamide |
|---|---|
| PubChem CID | 24806145 |
| Molecular Formula | C23H32N7O7PS |
| Molecular Weight | 581.59 g/mol |
| Exact Mass | 581.18 |
| IUPAC Name | 5-[(3aS,4S,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]-N-[[1-[2-[ethoxy-(4-nitrophenoxy)phosphoryl]ethyl]triazol-4-yl]methyl]pentanamide |
| SMILES | CCOP(=O)(CCn1cc(CNC(=O)CCCC[C@@H]2SC[C@@H]3NC(=O)N[C@@H]32)nn1)Oc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C23H32N7O7PS/c1-2-36-38(35,37-18-9-7-17(8-10-18)30(33)34)12-11-29-14-16(27-28-29)13-24-21(31)6-4-3-5-20-22-19(15-39-20)25-23(32)26-22/h7-10,14,19-20,22H,2-6,11-13,15H2,1H3,(H,24,31)(H2,25,26,32)/t19-,20-,22-,38?/m0/s1 |
| InChIKey | YRFQIQYMOTUSPB-DVCAQMBNSA-N |
| XLogP | 2.84 |
| TPSA | 179.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.59 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'biotin_analogue', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|