C17H28N6O3S — CID 89133004
N-[[1-(1-hydroxy-2-methylpropan-2-yl)triazol-4-yl]methyl]-5-(2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl)pentanamide (PubChem CID 89133004) has the molecular formula C17H28N6O3S and a molecular weight of 396.52 g/mol. Its IUPAC name is N-[[1-(1-hydroxy-2-methylpropan-2-yl)triazol-4-yl]methyl]-5-(2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl)pentanamide.
| Compound Name | N-[[1-(1-hydroxy-2-methylpropan-2-yl)triazol-4-yl]methyl]-5-(2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl)pentanamide |
|---|---|
| PubChem CID | 89133004 |
| Molecular Formula | C17H28N6O3S |
| Molecular Weight | 396.52 g/mol |
| Exact Mass | 396.19 |
| IUPAC Name | N-[[1-(1-hydroxy-2-methylpropan-2-yl)triazol-4-yl]methyl]-5-(2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl)pentanamide |
| SMILES | CC(C)(CO)n1cc(CNC(=O)CCCCC2SCC3NC(=O)NC32)nn1 |
| InChI | InChI=1S/C17H28N6O3S/c1-17(2,10-24)23-8-11(21-22-23)7-18-14(25)6-4-3-5-13-15-12(9-27-13)19-16(26)20-15/h8,12-13,15,24H,3-7,9-10H2,1-2H3,(H,18,25)(H2,19,20,26) |
| InChIKey | QIFVLTVRLVSRAY-UHFFFAOYSA-N |
| XLogP | 0.35 |
| TPSA | 121.17 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.52 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'biotin_analogue', 'substructure': 'N/A'} |
|---|