C25H34N6O4S — CID 146315798
5-[(3aS,4S,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]-N-[[4-[4-(oxan-2-yloxymethyl)triazol-1-yl]phenyl]methyl]pentanamide (PubChem CID 146315798) has the molecular formula C25H34N6O4S and a molecular weight of 514.65 g/mol. Its IUPAC name is 5-[(3aS,4S,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]-N-[[4-[4-(oxan-2-yloxymethyl)triazol-1-yl]phenyl]methyl]pentanamide.
| Compound Name | 5-[(3aS,4S,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]-N-[[4-[4-(oxan-2-yloxymethyl)triazol-1-yl]phenyl]methyl]pentanamide |
|---|---|
| PubChem CID | 146315798 |
| Molecular Formula | C25H34N6O4S |
| Molecular Weight | 514.65 g/mol |
| Exact Mass | 514.24 |
| IUPAC Name | 5-[(3aS,4S,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]-N-[[4-[4-(oxan-2-yloxymethyl)triazol-1-yl]phenyl]methyl]pentanamide |
| SMILES | O=C(CCCC[C@@H]1SC[C@@H]2NC(=O)N[C@@H]21)NCc1ccc(-n2cc(COC3CCCCO3)nn2)cc1 |
| InChI | InChI=1S/C25H34N6O4S/c32-22(6-2-1-5-21-24-20(16-36-21)27-25(33)28-24)26-13-17-8-10-19(11-9-17)31-14-18(29-30-31)15-35-23-7-3-4-12-34-23/h8-11,14,20-21,23-24H,1-7,12-13,15-16H2,(H,26,32)(H2,27,28,33)/t20-,21-,23?,24-/m0/s1 |
| InChIKey | KMEHOVVJQSYPFQ-BZKVFWFBSA-N |
| XLogP | 2.65 |
| TPSA | 119.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.65 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'biotin_analogue', 'substructure': 'N/A'} |
|---|