C19H28N6O2S — CID 10431351
5-[(3aS,4S,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]-N-[[4-(dimethylaminodiazenyl)phenyl]methyl]pentanamide (PubChem CID 10431351) has the molecular formula C19H28N6O2S and a molecular weight of 404.54 g/mol. Its IUPAC name is 5-[(3aS,4S,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]-N-[[4-(dimethylaminodiazenyl)phenyl]methyl]pentanamide.
| Compound Name | 5-[(3aS,4S,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]-N-[[4-(dimethylaminodiazenyl)phenyl]methyl]pentanamide |
|---|---|
| PubChem CID | 10431351 |
| Molecular Formula | C19H28N6O2S |
| Molecular Weight | 404.54 g/mol |
| Exact Mass | 404.20 |
| IUPAC Name | 5-[(3aS,4S,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]-N-[[4-(dimethylaminodiazenyl)phenyl]methyl]pentanamide |
| SMILES | CN(C)/N=N/c1ccc(CNC(=O)CCCC[C@@H]2SC[C@@H]3NC(=O)N[C@@H]32)cc1 |
| InChI | InChI=1S/C19H28N6O2S/c1-25(2)24-23-14-9-7-13(8-10-14)11-20-17(26)6-4-3-5-16-18-15(12-28-16)21-19(27)22-18/h7-10,15-16,18H,3-6,11-12H2,1-2H3,(H,20,26)(H2,21,22,27)/b24-23+/t15-,16-,18-/m0/s1 |
| InChIKey | MBFYYVNOMSTSAE-SSKIHYACSA-N |
| XLogP | 2.59 |
| TPSA | 98.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.54 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'biotin_analogue', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|