C30H47N5O5S — CID 167995219
N-[6-[2-(4-hydroxyphenyl)ethylamino]-6-oxohexyl]-6-[5-(2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl)pentanoylamino]hexanamide (PubChem CID 167995219) has the molecular formula C30H47N5O5S and a molecular weight of 589.80 g/mol. Its IUPAC name is N-[6-[2-(4-hydroxyphenyl)ethylamino]-6-oxohexyl]-6-[5-(2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl)pentanoylamino]hexanamide.
| Compound Name | N-[6-[2-(4-hydroxyphenyl)ethylamino]-6-oxohexyl]-6-[5-(2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl)pentanoylamino]hexanamide |
|---|---|
| PubChem CID | 167995219 |
| Molecular Formula | C30H47N5O5S |
| Molecular Weight | 589.80 g/mol |
| Exact Mass | 589.33 |
| IUPAC Name | N-[6-[2-(4-hydroxyphenyl)ethylamino]-6-oxohexyl]-6-[5-(2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl)pentanoylamino]hexanamide |
| SMILES | O=C(CCCCCNC(=O)CCCCC1SCC2NC(=O)NC21)NCCCCCC(=O)NCCc1ccc(O)cc1 |
| InChI | InChI=1S/C30H47N5O5S/c36-23-15-13-22(14-16-23)17-20-33-28(39)11-4-2-8-18-31-26(37)10-3-1-7-19-32-27(38)12-6-5-9-25-29-24(21-41-25)34-30(40)35-29/h13-16,24-25,29,36H,1-12,17-21H2,(H,31,37)(H,32,38)(H,33,39)(H2,34,35,40) |
| InChIKey | AONIROLXOSTVPV-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 148.66 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.80 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'biotin_analogue', 'substructure': 'N/A'} |
|---|