C26H37N7O4S — CID 59401048
N-[4-[1-[2-[2-(4-hydroxyphenyl)ethylamino]-2-oxoethyl]triazol-4-yl]butyl]-5-(2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl)pentanamide (PubChem CID 59401048) has the molecular formula C26H37N7O4S and a molecular weight of 543.69 g/mol. Its IUPAC name is N-[4-[1-[2-[2-(4-hydroxyphenyl)ethylamino]-2-oxoethyl]triazol-4-yl]butyl]-5-(2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl)pentanamide.
| Compound Name | N-[4-[1-[2-[2-(4-hydroxyphenyl)ethylamino]-2-oxoethyl]triazol-4-yl]butyl]-5-(2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl)pentanamide |
|---|---|
| PubChem CID | 59401048 |
| Molecular Formula | C26H37N7O4S |
| Molecular Weight | 543.69 g/mol |
| Exact Mass | 543.26 |
| IUPAC Name | N-[4-[1-[2-[2-(4-hydroxyphenyl)ethylamino]-2-oxoethyl]triazol-4-yl]butyl]-5-(2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl)pentanamide |
| SMILES | O=C(CCCCC1SCC2NC(=O)NC21)NCCCCc1cn(CC(=O)NCCc2ccc(O)cc2)nn1 |
| InChI | InChI=1S/C26H37N7O4S/c34-20-10-8-18(9-11-20)12-14-28-24(36)16-33-15-19(31-32-33)5-3-4-13-27-23(35)7-2-1-6-22-25-21(17-38-22)29-26(37)30-25/h8-11,15,21-22,25,34H,1-7,12-14,16-17H2,(H,27,35)(H,28,36)(H2,29,30,37) |
| InChIKey | XGWHUKUGUBNBEM-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 150.27 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.69 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'biotin_analogue', 'substructure': 'N/A'} |
|---|