C23H33N5O3S — CID 30458613
2-[4-[5-[(3aS,4S,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]pentanoyl]piperazin-1-yl]-N-benzylacetamide (PubChem CID 30458613) has the molecular formula C23H33N5O3S and a molecular weight of 459.62 g/mol. Its IUPAC name is 2-[4-[5-[(3aS,4S,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]pentanoyl]piperazin-1-yl]-N-benzylacetamide.
| Compound Name | 2-[4-[5-[(3aS,4S,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]pentanoyl]piperazin-1-yl]-N-benzylacetamide |
|---|---|
| PubChem CID | 30458613 |
| Molecular Formula | C23H33N5O3S |
| Molecular Weight | 459.62 g/mol |
| Exact Mass | 459.23 |
| IUPAC Name | 2-[4-[5-[(3aS,4S,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]pentanoyl]piperazin-1-yl]-N-benzylacetamide |
| SMILES | O=C(CN1CCN(C(=O)CCCC[C@@H]2SC[C@@H]3NC(=O)N[C@@H]32)CC1)NCc1ccccc1 |
| InChI | InChI=1S/C23H33N5O3S/c29-20(24-14-17-6-2-1-3-7-17)15-27-10-12-28(13-11-27)21(30)9-5-4-8-19-22-18(16-32-19)25-23(31)26-22/h1-3,6-7,18-19,22H,4-5,8-16H2,(H,24,29)(H2,25,26,31)/t18-,19-,22-/m0/s1 |
| InChIKey | PJFADUKXKAXAGO-IPJJNNNSSA-N |
| XLogP | 1.17 |
| TPSA | 93.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.62 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'biotin_analogue', 'substructure': 'N/A'} |
|---|