C15H27N5O2S — CID 59981250
5-(2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl)-N-(piperazin-1-ylmethyl)pentanamide (PubChem CID 59981250) has the molecular formula C15H27N5O2S and a molecular weight of 341.48 g/mol. Its IUPAC name is 5-(2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl)-N-(piperazin-1-ylmethyl)pentanamide.
| Compound Name | 5-(2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl)-N-(piperazin-1-ylmethyl)pentanamide |
|---|---|
| PubChem CID | 59981250 |
| Molecular Formula | C15H27N5O2S |
| Molecular Weight | 341.48 g/mol |
| Exact Mass | 341.19 |
| IUPAC Name | 5-(2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl)-N-(piperazin-1-ylmethyl)pentanamide |
| SMILES | O=C(CCCCC1SCC2NC(=O)NC21)NCN1CCNCC1 |
| InChI | InChI=1S/C15H27N5O2S/c21-13(17-10-20-7-5-16-6-8-20)4-2-1-3-12-14-11(9-23-12)18-15(22)19-14/h11-12,14,16H,1-10H2,(H,17,21)(H2,18,19,22) |
| InChIKey | GSCIACDJDOCYOQ-UHFFFAOYSA-N |
| XLogP | -0.31 |
| TPSA | 85.50 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.48 |
| LogP ≤ 5 | -0.31 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'biotin_analogue', 'substructure': 'N/A'} |
|---|