C29H33N7O2S — CID 126540605
5-[(3aR,4R,6aS)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]-N-[[4-[(4-amino-2-methylimidazo[4,5-c]quinolin-1-yl)methyl]phenyl]methyl]pentanamide (PubChem CID 126540605) has the molecular formula C29H33N7O2S and a molecular weight of 543.70 g/mol. Its IUPAC name is 5-[(3aR,4R,6aS)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]-N-[[4-[(4-amino-2-methylimidazo[4,5-c]quinolin-1-yl)methyl]phenyl]methyl]pentanamide.
| Compound Name | 5-[(3aR,4R,6aS)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]-N-[[4-[(4-amino-2-methylimidazo[4,5-c]quinolin-1-yl)methyl]phenyl]methyl]pentanamide |
|---|---|
| PubChem CID | 126540605 |
| Molecular Formula | C29H33N7O2S |
| Molecular Weight | 543.70 g/mol |
| Exact Mass | 543.24 |
| IUPAC Name | 5-[(3aR,4R,6aS)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]-N-[[4-[(4-amino-2-methylimidazo[4,5-c]quinolin-1-yl)methyl]phenyl]methyl]pentanamide |
| SMILES | Cc1nc2c(N)nc3ccccc3c2n1Cc1ccc(CNC(=O)CCCC[C@H]2SC[C@H]3NC(=O)N[C@H]32)cc1 |
| InChI | InChI=1S/C29H33N7O2S/c1-17-32-26-27(20-6-2-3-7-21(20)33-28(26)30)36(17)15-19-12-10-18(11-13-19)14-31-24(37)9-5-4-8-23-25-22(16-39-23)34-29(38)35-25/h2-3,6-7,10-13,22-23,25H,4-5,8-9,14-16H2,1H3,(H2,30,33)(H,31,37)(H2,34,35,38)/t22-,23-,25-/m1/s1 |
| InChIKey | KLTSJSINNZUELF-VDKIKQQVSA-N |
| XLogP | 3.87 |
| TPSA | 126.96 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.70 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'biotin_analogue', 'substructure': 'N/A'} |
|---|