C45H46N10O2 — CID 130419601
N,N'-bis[[4-[(4-amino-2-methylimidazo[4,5-c]quinolin-1-yl)methyl]phenyl]methyl]-3-methylhexanediamide (PubChem CID 130419601) has the molecular formula C45H46N10O2 and a molecular weight of 758.93 g/mol. Its IUPAC name is N,N'-bis[[4-[(4-amino-2-methylimidazo[4,5-c]quinolin-1-yl)methyl]phenyl]methyl]-3-methylhexanediamide.
| Compound Name | N,N'-bis[[4-[(4-amino-2-methylimidazo[4,5-c]quinolin-1-yl)methyl]phenyl]methyl]-3-methylhexanediamide |
|---|---|
| PubChem CID | 130419601 |
| Molecular Formula | C45H46N10O2 |
| Molecular Weight | 758.93 g/mol |
| Exact Mass | 758.38 |
| IUPAC Name | N,N'-bis[[4-[(4-amino-2-methylimidazo[4,5-c]quinolin-1-yl)methyl]phenyl]methyl]-3-methylhexanediamide |
| SMILES | Cc1nc2c(N)nc3ccccc3c2n1Cc1ccc(CNC(=O)CCC(C)CC(=O)NCc2ccc(Cn3c(C)nc4c(N)nc5ccccc5c43)cc2)cc1 |
| InChI | InChI=1S/C45H46N10O2/c1-27(22-39(57)49-24-31-15-19-33(20-16-31)26-55-29(3)51-41-43(55)35-9-5-7-11-37(35)53-45(41)47)12-21-38(56)48-23-30-13-17-32(18-14-30)25-54-28(2)50-40-42(54)34-8-4-6-10-36(34)52-44(40)46/h4-11,13-20,27H,12,21-26H2,1-3H3,(H2,46,52)(H2,47,53)(H,48,56)(H,49,57) |
| InChIKey | WGQLNNMEROFVKT-UHFFFAOYSA-N |
| XLogP | 7.10 |
| TPSA | 171.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 758.93 |
| LogP ≤ 5 | 7.10 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |