C56H68N10O2 — CID 134506273
N,N'-bis[[4-[(4-amino-2-butylimidazo[4,5-c]quinolin-1-yl)methyl]phenyl]methyl]-3-hexylhexanediamide (PubChem CID 134506273) has the molecular formula C56H68N10O2 and a molecular weight of 913.23 g/mol. Its IUPAC name is N,N'-bis[[4-[(4-amino-2-butylimidazo[4,5-c]quinolin-1-yl)methyl]phenyl]methyl]-3-hexylhexanediamide.
| Compound Name | N,N'-bis[[4-[(4-amino-2-butylimidazo[4,5-c]quinolin-1-yl)methyl]phenyl]methyl]-3-hexylhexanediamide |
|---|---|
| PubChem CID | 134506273 |
| Molecular Formula | C56H68N10O2 |
| Molecular Weight | 913.23 g/mol |
| Exact Mass | 912.55 |
| IUPAC Name | N,N'-bis[[4-[(4-amino-2-butylimidazo[4,5-c]quinolin-1-yl)methyl]phenyl]methyl]-3-hexylhexanediamide |
| SMILES | CCCCCCC(CCC(=O)NCc1ccc(Cn2c(CCCC)nc3c(N)nc4ccccc4c32)cc1)CC(=O)NCc1ccc(Cn2c(CCCC)nc3c(N)nc4ccccc4c32)cc1 |
| InChI | InChI=1S/C56H68N10O2/c1-4-7-10-11-16-38(33-50(68)60-35-40-25-29-42(30-26-40)37-66-48(22-9-6-3)64-52-54(66)44-18-13-15-20-46(44)62-56(52)58)31-32-49(67)59-34-39-23-27-41(28-24-39)36-65-47(21-8-5-2)63-51-53(65)43-17-12-14-19-45(43)61-55(51)57/h12-15,17-20,23-30,38H,4-11,16,21-22,31-37H2,1-3H3,(H2,57,61)(H2,58,62)(H,59,67)(H,60,68) |
| InChIKey | NFRCECGPWDJPOA-UHFFFAOYSA-N |
| XLogP | 11.12 |
| TPSA | 171.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 68 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 913.23 |
| LogP ≤ 5 | 11.12 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|