C29H30BN5O3 — CID 71009411
[4-[[4-[(4-amino-2-butylimidazo[4,5-c]quinolin-1-yl)methyl]phenyl]methylcarbamoyl]phenyl]boronic acid (PubChem CID 71009411) has the molecular formula C29H30BN5O3 and a molecular weight of 507.40 g/mol. Its IUPAC name is [4-[[4-[(4-amino-2-butylimidazo[4,5-c]quinolin-1-yl)methyl]phenyl]methylcarbamoyl]phenyl]boronic acid.
| Compound Name | [4-[[4-[(4-amino-2-butylimidazo[4,5-c]quinolin-1-yl)methyl]phenyl]methylcarbamoyl]phenyl]boronic acid |
|---|---|
| PubChem CID | 71009411 |
| Molecular Formula | C29H30BN5O3 |
| Molecular Weight | 507.40 g/mol |
| Exact Mass | 507.24 |
| IUPAC Name | [4-[[4-[(4-amino-2-butylimidazo[4,5-c]quinolin-1-yl)methyl]phenyl]methylcarbamoyl]phenyl]boronic acid |
| SMILES | CCCCc1nc2c(N)nc3ccccc3c2n1Cc1ccc(CNC(=O)c2ccc(B(O)O)cc2)cc1 |
| InChI | InChI=1S/C29H30BN5O3/c1-2-3-8-25-34-26-27(23-6-4-5-7-24(23)33-28(26)31)35(25)18-20-11-9-19(10-12-20)17-32-29(36)21-13-15-22(16-14-21)30(37)38/h4-7,9-16,37-38H,2-3,8,17-18H2,1H3,(H2,31,33)(H,32,36) |
| InChIKey | MMFKYNGNJDBYJN-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 126.29 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.40 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|