C24H27N5O — CID 23512725
N-[3-(4-amino-2-butylimidazo[4,5-c]quinolin-1-yl)propyl]benzamide (PubChem CID 23512725) has the molecular formula C24H27N5O and a molecular weight of 401.51 g/mol. Its IUPAC name is N-[3-(4-amino-2-butylimidazo[4,5-c]quinolin-1-yl)propyl]benzamide.
| Compound Name | N-[3-(4-amino-2-butylimidazo[4,5-c]quinolin-1-yl)propyl]benzamide |
|---|---|
| PubChem CID | 23512725 |
| Molecular Formula | C24H27N5O |
| Molecular Weight | 401.51 g/mol |
| Exact Mass | 401.22 |
| IUPAC Name | N-[3-(4-amino-2-butylimidazo[4,5-c]quinolin-1-yl)propyl]benzamide |
| SMILES | CCCCc1nc2c(N)nc3ccccc3c2n1CCCNC(=O)c1ccccc1 |
| InChI | InChI=1S/C24H27N5O/c1-2-3-14-20-28-21-22(18-12-7-8-13-19(18)27-23(21)25)29(20)16-9-15-26-24(30)17-10-5-4-6-11-17/h4-8,10-13H,2-3,9,14-16H2,1H3,(H2,25,27)(H,26,30) |
| InChIKey | YTWBMRXEDRJFTK-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 85.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.51 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|