C25H29ClN6O — CID 22985761
1-[4-(4-amino-2-butylimidazo[4,5-c]quinolin-1-yl)butyl]-3-(2-chlorophenyl)urea (PubChem CID 22985761) has the molecular formula C25H29ClN6O and a molecular weight of 465.00 g/mol. Its IUPAC name is 1-[4-(4-amino-2-butylimidazo[4,5-c]quinolin-1-yl)butyl]-3-(2-chlorophenyl)urea.
| Compound Name | 1-[4-(4-amino-2-butylimidazo[4,5-c]quinolin-1-yl)butyl]-3-(2-chlorophenyl)urea |
|---|---|
| PubChem CID | 22985761 |
| Molecular Formula | C25H29ClN6O |
| Molecular Weight | 465.00 g/mol |
| Exact Mass | 464.21 |
| IUPAC Name | 1-[4-(4-amino-2-butylimidazo[4,5-c]quinolin-1-yl)butyl]-3-(2-chlorophenyl)urea |
| SMILES | CCCCc1nc2c(N)nc3ccccc3c2n1CCCCNC(=O)Nc1ccccc1Cl |
| InChI | InChI=1S/C25H29ClN6O/c1-2-3-14-21-31-22-23(17-10-4-6-12-19(17)29-24(22)27)32(21)16-9-8-15-28-25(33)30-20-13-7-5-11-18(20)26/h4-7,10-13H,2-3,8-9,14-16H2,1H3,(H2,27,29)(H2,28,30,33) |
| InChIKey | SLSTVCHZKMIULJ-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 97.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.00 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|