C24H31ClN6O2 — CID 159994347
1-[4-[4-amino-2-(2-methoxyethyl)imidazo[4,5-c]quinolin-1-yl]butyl]-3-(2-chlorophenyl)urea;molecular hydrogen (PubChem CID 159994347) has the molecular formula C24H31ClN6O2 and a molecular weight of 471.01 g/mol. Its IUPAC name is 1-[4-[4-amino-2-(2-methoxyethyl)imidazo[4,5-c]quinolin-1-yl]butyl]-3-(2-chlorophenyl)urea;molecular hydrogen.
| Compound Name | 1-[4-[4-amino-2-(2-methoxyethyl)imidazo[4,5-c]quinolin-1-yl]butyl]-3-(2-chlorophenyl)urea;molecular hydrogen |
|---|---|
| PubChem CID | 159994347 |
| Molecular Formula | C24H31ClN6O2 |
| Molecular Weight | 471.01 g/mol |
| Exact Mass | 470.22 |
| IUPAC Name | 1-[4-[4-amino-2-(2-methoxyethyl)imidazo[4,5-c]quinolin-1-yl]butyl]-3-(2-chlorophenyl)urea;molecular hydrogen |
| SMILES | COCCc1nc2c(N)nc3ccccc3c2n1CCCCNC(=O)Nc1ccccc1Cl.[H][H].[H][H] |
| InChI | InChI=1S/C24H27ClN6O2.2H2/c1-33-15-12-20-30-21-22(16-8-2-4-10-18(16)28-23(21)26)31(20)14-7-6-13-27-24(32)29-19-11-5-3-9-17(19)25;;/h2-5,8-11H,6-7,12-15H2,1H3,(H2,26,28)(H2,27,29,32);2*1H |
| InChIKey | OHISAJCCOZBJRG-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 107.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.01 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|