C23H25ClFN5OS — CID 142033110
1-[4-[(2-chloro-4-fluorophenyl)sulfanylamino]butyl]-2-(2-methoxyethyl)imidazo[4,5-c]quinolin-4-amine (PubChem CID 142033110) has the molecular formula C23H25ClFN5OS and a molecular weight of 474.01 g/mol. Its IUPAC name is 1-[4-[(2-chloro-4-fluorophenyl)sulfanylamino]butyl]-2-(2-methoxyethyl)imidazo[4,5-c]quinolin-4-amine.
| Compound Name | 1-[4-[(2-chloro-4-fluorophenyl)sulfanylamino]butyl]-2-(2-methoxyethyl)imidazo[4,5-c]quinolin-4-amine |
|---|---|
| PubChem CID | 142033110 |
| Molecular Formula | C23H25ClFN5OS |
| Molecular Weight | 474.01 g/mol |
| Exact Mass | 473.15 |
| IUPAC Name | 1-[4-[(2-chloro-4-fluorophenyl)sulfanylamino]butyl]-2-(2-methoxyethyl)imidazo[4,5-c]quinolin-4-amine |
| SMILES | COCCc1nc2c(N)nc3ccccc3c2n1CCCCNSc1ccc(F)cc1Cl |
| InChI | InChI=1S/C23H25ClFN5OS/c1-31-13-10-20-29-21-22(16-6-2-3-7-18(16)28-23(21)26)30(20)12-5-4-11-27-32-19-9-8-15(25)14-17(19)24/h2-3,6-9,14,27H,4-5,10-13H2,1H3,(H2,26,28) |
| InChIKey | ASITYTKUUBGVTI-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 77.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.01 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|