C29H39N5S — CID 142033105
2-butyl-1-[4-[(2,3,4,5,6-pentamethylphenyl)sulfanylamino]butyl]imidazo[4,5-c]quinolin-4-amine (PubChem CID 142033105) has the molecular formula C29H39N5S and a molecular weight of 489.73 g/mol. Its IUPAC name is 2-butyl-1-[4-[(2,3,4,5,6-pentamethylphenyl)sulfanylamino]butyl]imidazo[4,5-c]quinolin-4-amine.
| Compound Name | 2-butyl-1-[4-[(2,3,4,5,6-pentamethylphenyl)sulfanylamino]butyl]imidazo[4,5-c]quinolin-4-amine |
|---|---|
| PubChem CID | 142033105 |
| Molecular Formula | C29H39N5S |
| Molecular Weight | 489.73 g/mol |
| Exact Mass | 489.29 |
| IUPAC Name | 2-butyl-1-[4-[(2,3,4,5,6-pentamethylphenyl)sulfanylamino]butyl]imidazo[4,5-c]quinolin-4-amine |
| SMILES | CCCCc1nc2c(N)nc3ccccc3c2n1CCCCNSc1c(C)c(C)c(C)c(C)c1C |
| InChI | InChI=1S/C29H39N5S/c1-7-8-15-25-33-26-27(23-13-9-10-14-24(23)32-29(26)30)34(25)17-12-11-16-31-35-28-21(5)19(3)18(2)20(4)22(28)6/h9-10,13-14,31H,7-8,11-12,15-17H2,1-6H3,(H2,30,32) |
| InChIKey | BDGSGWBJXVFONC-UHFFFAOYSA-N |
| XLogP | 7.13 |
| TPSA | 68.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.73 |
| LogP ≤ 5 | 7.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|