C26H35N6OS+ — CID 142033082
[5-[4-(4-amino-2-butylimidazo[4,5-c]quinolin-1-yl)butylamino]sulfanyl-2-methylphenyl]-methoxyazanium (PubChem CID 142033082) has the molecular formula C26H35N6OS+ and a molecular weight of 479.67 g/mol. Its IUPAC name is [5-[4-(4-amino-2-butylimidazo[4,5-c]quinolin-1-yl)butylamino]sulfanyl-2-methylphenyl]-methoxyazanium.
| Compound Name | [5-[4-(4-amino-2-butylimidazo[4,5-c]quinolin-1-yl)butylamino]sulfanyl-2-methylphenyl]-methoxyazanium |
|---|---|
| PubChem CID | 142033082 |
| Molecular Formula | C26H35N6OS+ |
| Molecular Weight | 479.67 g/mol |
| Exact Mass | 479.26 |
| IUPAC Name | [5-[4-(4-amino-2-butylimidazo[4,5-c]quinolin-1-yl)butylamino]sulfanyl-2-methylphenyl]-methoxyazanium |
| SMILES | CCCCc1nc2c(N)nc3ccccc3c2n1CCCCNSc1ccc(C)c([NH2+]OC)c1 |
| InChI | InChI=1S/C26H34N6OS/c1-4-5-12-23-30-24-25(20-10-6-7-11-21(20)29-26(24)27)32(23)16-9-8-15-28-34-19-14-13-18(2)22(17-19)31-33-3/h6-7,10-11,13-14,17,28,31H,4-5,8-9,12,15-16H2,1-3H3,(H2,27,29)/p+1 |
| InChIKey | NEMMOWAJSLFSGC-UHFFFAOYSA-O |
| XLogP | 4.65 |
| TPSA | 94.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.67 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|