C24H31ClN6O2S — CID 22491707
3-[4-(4-amino-2-butylimidazo[4,5-c]quinolin-1-yl)butylamino]benzenesulfonamide;hydrochloride (PubChem CID 22491707) has the molecular formula C24H31ClN6O2S and a molecular weight of 503.07 g/mol. Its IUPAC name is 3-[4-(4-amino-2-butylimidazo[4,5-c]quinolin-1-yl)butylamino]benzenesulfonamide;hydrochloride.
| Compound Name | 3-[4-(4-amino-2-butylimidazo[4,5-c]quinolin-1-yl)butylamino]benzenesulfonamide;hydrochloride |
|---|---|
| PubChem CID | 22491707 |
| Molecular Formula | C24H31ClN6O2S |
| Molecular Weight | 503.07 g/mol |
| Exact Mass | 502.19 |
| IUPAC Name | 3-[4-(4-amino-2-butylimidazo[4,5-c]quinolin-1-yl)butylamino]benzenesulfonamide;hydrochloride |
| SMILES | CCCCc1nc2c(N)nc3ccccc3c2n1CCCCNc1cccc(S(N)(=O)=O)c1.Cl |
| InChI | InChI=1S/C24H30N6O2S.ClH/c1-2-3-13-21-29-22-23(19-11-4-5-12-20(19)28-24(22)25)30(21)15-7-6-14-27-17-9-8-10-18(16-17)33(26,31)32;/h4-5,8-12,16,27H,2-3,6-7,13-15H2,1H3,(H2,25,28)(H2,26,31,32);1H |
| InChIKey | FHBAFLRDHQLXHV-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 128.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.07 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|