C26H27N5O2S — CID 20713987
N-[2-(4-amino-2-butylimidazo[4,5-c]quinolin-1-yl)ethyl]naphthalene-1-sulfonamide (PubChem CID 20713987) has the molecular formula C26H27N5O2S and a molecular weight of 473.60 g/mol. Its IUPAC name is N-[2-(4-amino-2-butylimidazo[4,5-c]quinolin-1-yl)ethyl]naphthalene-1-sulfonamide.
| Compound Name | N-[2-(4-amino-2-butylimidazo[4,5-c]quinolin-1-yl)ethyl]naphthalene-1-sulfonamide |
|---|---|
| PubChem CID | 20713987 |
| Molecular Formula | C26H27N5O2S |
| Molecular Weight | 473.60 g/mol |
| Exact Mass | 473.19 |
| IUPAC Name | N-[2-(4-amino-2-butylimidazo[4,5-c]quinolin-1-yl)ethyl]naphthalene-1-sulfonamide |
| SMILES | CCCCc1nc2c(N)nc3ccccc3c2n1CCNS(=O)(=O)c1cccc2ccccc12 |
| InChI | InChI=1S/C26H27N5O2S/c1-2-3-15-23-30-24-25(20-12-6-7-13-21(20)29-26(24)27)31(23)17-16-28-34(32,33)22-14-8-10-18-9-4-5-11-19(18)22/h4-14,28H,2-3,15-17H2,1H3,(H2,27,29) |
| InChIKey | UIKBOMYGOQNFPH-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 102.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.60 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |