C25H31N5O5S2 — CID 20613699
N-[2-[2-(4-amino-2-butylimidazo[4,5-c]quinolin-1-yl)ethoxy]ethyl]-4-methylsulfonylbenzenesulfonamide (PubChem CID 20613699) has the molecular formula C25H31N5O5S2 and a molecular weight of 545.69 g/mol. Its IUPAC name is N-[2-[2-(4-amino-2-butylimidazo[4,5-c]quinolin-1-yl)ethoxy]ethyl]-4-methylsulfonylbenzenesulfonamide.
| Compound Name | N-[2-[2-(4-amino-2-butylimidazo[4,5-c]quinolin-1-yl)ethoxy]ethyl]-4-methylsulfonylbenzenesulfonamide |
|---|---|
| PubChem CID | 20613699 |
| Molecular Formula | C25H31N5O5S2 |
| Molecular Weight | 545.69 g/mol |
| Exact Mass | 545.18 |
| IUPAC Name | N-[2-[2-(4-amino-2-butylimidazo[4,5-c]quinolin-1-yl)ethoxy]ethyl]-4-methylsulfonylbenzenesulfonamide |
| SMILES | CCCCc1nc2c(N)nc3ccccc3c2n1CCOCCNS(=O)(=O)c1ccc(S(C)(=O)=O)cc1 |
| InChI | InChI=1S/C25H31N5O5S2/c1-3-4-9-22-29-23-24(20-7-5-6-8-21(20)28-25(23)26)30(22)15-17-35-16-14-27-37(33,34)19-12-10-18(11-13-19)36(2,31)32/h5-8,10-13,27H,3-4,9,14-17H2,1-2H3,(H2,26,28) |
| InChIKey | SCAFECFQJIANQB-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 146.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.69 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|