C27H35N5O2 — CID 142145306
N-[2-[2-(4-amino-2-butylimidazo[4,5-c]quinolin-1-yl)ethoxy]ethyl]benzamide;ethane (PubChem CID 142145306) has the molecular formula C27H35N5O2 and a molecular weight of 461.61 g/mol. Its IUPAC name is N-[2-[2-(4-amino-2-butylimidazo[4,5-c]quinolin-1-yl)ethoxy]ethyl]benzamide;ethane.
| Compound Name | N-[2-[2-(4-amino-2-butylimidazo[4,5-c]quinolin-1-yl)ethoxy]ethyl]benzamide;ethane |
|---|---|
| PubChem CID | 142145306 |
| Molecular Formula | C27H35N5O2 |
| Molecular Weight | 461.61 g/mol |
| Exact Mass | 461.28 |
| IUPAC Name | N-[2-[2-(4-amino-2-butylimidazo[4,5-c]quinolin-1-yl)ethoxy]ethyl]benzamide;ethane |
| SMILES | CC.CCCCc1nc2c(N)nc3ccccc3c2n1CCOCCNC(=O)c1ccccc1 |
| InChI | InChI=1S/C25H29N5O2.C2H6/c1-2-3-13-21-29-22-23(19-11-7-8-12-20(19)28-24(22)26)30(21)15-17-32-16-14-27-25(31)18-9-5-4-6-10-18;1-2/h4-12H,2-3,13-17H2,1H3,(H2,26,28)(H,27,31);1-2H3 |
| InChIKey | VYJZFHQQPRQQLR-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 95.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.61 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|