C22H30N6O2 — CID 142145309
N-[2-[2-[4-amino-2-[3-(methylamino)propyl]imidazo[4,5-c]quinolin-1-yl]ethoxy]ethyl]cyclopropanecarboxamide (PubChem CID 142145309) has the molecular formula C22H30N6O2 and a molecular weight of 410.52 g/mol. Its IUPAC name is N-[2-[2-[4-amino-2-[3-(methylamino)propyl]imidazo[4,5-c]quinolin-1-yl]ethoxy]ethyl]cyclopropanecarboxamide.
| Compound Name | N-[2-[2-[4-amino-2-[3-(methylamino)propyl]imidazo[4,5-c]quinolin-1-yl]ethoxy]ethyl]cyclopropanecarboxamide |
|---|---|
| PubChem CID | 142145309 |
| Molecular Formula | C22H30N6O2 |
| Molecular Weight | 410.52 g/mol |
| Exact Mass | 410.24 |
| IUPAC Name | N-[2-[2-[4-amino-2-[3-(methylamino)propyl]imidazo[4,5-c]quinolin-1-yl]ethoxy]ethyl]cyclopropanecarboxamide |
| SMILES | CNCCCc1nc2c(N)nc3ccccc3c2n1CCOCCNC(=O)C1CC1 |
| InChI | InChI=1S/C22H30N6O2/c1-24-10-4-7-18-27-19-20(16-5-2-3-6-17(16)26-21(19)23)28(18)12-14-30-13-11-25-22(29)15-8-9-15/h2-3,5-6,15,24H,4,7-14H2,1H3,(H2,23,26)(H,25,29) |
| InChIKey | GXNZFXZQBUDBPP-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 107.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.52 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|