C17H23N5O — CID 142032833
2-[4-amino-1-[4-(methylamino)butyl]imidazo[4,5-c]quinolin-2-yl]ethanol (PubChem CID 142032833) has the molecular formula C17H23N5O and a molecular weight of 313.41 g/mol. Its IUPAC name is 2-[4-amino-1-[4-(methylamino)butyl]imidazo[4,5-c]quinolin-2-yl]ethanol.
| Compound Name | 2-[4-amino-1-[4-(methylamino)butyl]imidazo[4,5-c]quinolin-2-yl]ethanol |
|---|---|
| PubChem CID | 142032833 |
| Molecular Formula | C17H23N5O |
| Molecular Weight | 313.41 g/mol |
| Exact Mass | 313.19 |
| IUPAC Name | 2-[4-amino-1-[4-(methylamino)butyl]imidazo[4,5-c]quinolin-2-yl]ethanol |
| SMILES | CNCCCCn1c(CCO)nc2c(N)nc3ccccc3c21 |
| InChI | InChI=1S/C17H23N5O/c1-19-9-4-5-10-22-14(8-11-23)21-15-16(22)12-6-2-3-7-13(12)20-17(15)18/h2-3,6-7,19,23H,4-5,8-11H2,1H3,(H2,18,20) |
| InChIKey | QPGBUZSWIPJNAO-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 88.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.41 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|